C18H23N5O5 — CID 29309974
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-methyl-3-nitrobenzamide (PubChem CID 29309974) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-methyl-3-nitrobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 29309974 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-2-methyl-3-nitrobenzamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)c2cccc([N+](=O)[O-])c2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H23N5O5/c1-4-6-10-22-15(19)14(16(24)20-18(22)26)21(5-2)17(25)12-8-7-9-13(11(12)3)23(27)28/h7-9H,4-6,10,19H2,1-3H3,(H,20,24,26) |
| InChIKey | INYBAXFCTPVREM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|