C19H20N6O7 — CID 55339175
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55339175) has the molecular formula C19H20N6O7 and a molecular weight of 444.40 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55339175 |
| Molecular Formula | C19H20N6O7 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CCCCn1c(N)c(N(C)C(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H20N6O7/c1-3-4-8-23-15(20)14(16(27)21-19(23)30)22(2)12(26)9-24-17(28)10-6-5-7-11(25(31)32)13(10)18(24)29/h5-7H,3-4,8-9,20H2,1-2H3,(H,21,27,30) |
| InChIKey | DOYBJGCICIXBEB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 181.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|