C21H24FN4O+ — CID 8704113
N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide (PubChem CID 8704113) has the molecular formula C21H24FN4O+ and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 8704113 |
| Molecular Formula | C21H24FN4O+ |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-phenylacetamide |
| SMILES | N#CCCN(C(=O)C[NH+]1CCN(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23FN4O/c22-18-7-9-19(10-8-18)25-15-13-24(14-16-25)17-21(27)26(12-4-11-23)20-5-2-1-3-6-20/h1-3,5-10H,4,12-17H2/p+1 |
| InChIKey | GYEPDWXFYFCBHX-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 51.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |