C17H21F3N4OS — CID 8618071
1-(2-cyanoethyl)-3-(2-morpholin-4-ylethyl)-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 8618071) has the molecular formula C17H21F3N4OS and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(2-morpholin-4-ylethyl)-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(2-cyanoethyl)-3-(2-morpholin-4-ylethyl)-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 8618071 |
| Molecular Formula | C17H21F3N4OS |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(2-morpholin-4-ylethyl)-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | N#CCCN(C(=S)NCCN1CCOCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N4OS/c18-17(19,20)14-3-1-4-15(13-14)24(7-2-5-21)16(26)22-6-8-23-9-11-25-12-10-23/h1,3-4,13H,2,6-12H2,(H,22,26) |
| InChIKey | QVMVRQXPIFOHJN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|