C16H25N4O3+ — CID 7585524
N'-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ium-4-ylethyl)oxamide (PubChem CID 7585524) has the molecular formula C16H25N4O3+ and a molecular weight of 321.40 g/mol. Its IUPAC name is N'-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ium-4-ylethyl)oxamide.
| Compound Name | N'-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 7585524 |
| Molecular Formula | C16H25N4O3+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N'-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H24N4O3/c1-19(2)14-5-3-13(4-6-14)18-16(22)15(21)17-7-8-20-9-11-23-12-10-20/h3-6H,7-12H2,1-2H3,(H,17,21)(H,18,22)/p+1 |
| InChIKey | JXFVBCOKKIUPSB-UHFFFAOYSA-O |
| XLogP | -1.28 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|