C8H17N4O3+ — CID 7405671
2-hydrazinyl-N-(2-morpholin-4-ium-4-ylethyl)-2-oxoacetamide (PubChem CID 7405671) has the molecular formula C8H17N4O3+ and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-morpholin-4-ium-4-ylethyl)-2-oxoacetamide.
| Compound Name | 2-hydrazinyl-N-(2-morpholin-4-ium-4-ylethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 7405671 |
| Molecular Formula | C8H17N4O3+ |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-hydrazinyl-N-(2-morpholin-4-ium-4-ylethyl)-2-oxoacetamide |
| SMILES | NNC(=O)C(=O)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C8H16N4O3/c9-11-8(14)7(13)10-1-2-12-3-5-15-6-4-12/h1-6,9H2,(H,10,13)(H,11,14)/p+1 |
| InChIKey | NUIDQMIKTGVUMX-UHFFFAOYSA-O |
| XLogP | -3.99 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|