C18H27N2O2+ — CID 6987548
N-(2-morpholin-4-ium-4-ylethyl)-1-phenylcyclopentane-1-carboxamide (PubChem CID 6987548) has the molecular formula C18H27N2O2+ and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 6987548 |
| Molecular Formula | C18H27N2O2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)-1-phenylcyclopentane-1-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H26N2O2/c21-17(19-10-11-20-12-14-22-15-13-20)18(8-4-5-9-18)16-6-2-1-3-7-16/h1-3,6-7H,4-5,8-15H2,(H,19,21)/p+1 |
| InChIKey | GBTLWBISICGQLQ-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |