C17H30N3OS+ — CID 8014535
1-(1-adamantyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8014535) has the molecular formula C17H30N3OS+ and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(1-adamantyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8014535 |
| Molecular Formula | C17H30N3OS+ |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-(1-adamantyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29N3OS/c22-16(18-1-2-20-3-5-21-6-4-20)19-17-10-13-7-14(11-17)9-15(8-13)12-17/h13-15H,1-12H2,(H2,18,19,22)/p+1 |
| InChIKey | IKZVBWHQVLOHKC-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|