C16H15FN4OS — CID 135733425
1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]thiourea (PubChem CID 135733425) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]thiourea |
|---|---|
| PubChem CID | 135733425 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]thiourea |
| SMILES | Oc1[nH]c2ccc(F)cc2c1/N=N/C(=S)N[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H15FN4OS/c17-10-3-4-12-11(7-10)14(15(22)18-12)20-21-16(23)19-13-6-8-1-2-9(13)5-8/h1-4,7-9,13,18,22H,5-6H2,(H,19,23)/b21-20+/t8-,9-,13-/m0/s1 |
| InChIKey | GTHGUFKCPZNBFB-ZOUGCTIASA-N |
| XLogP | 3.94 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|