C15H17N5O3S — CID 3990281
1-cyclohexyl-3-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]thiourea (PubChem CID 3990281) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]thiourea |
|---|---|
| PubChem CID | 3990281 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-cyclohexyl-3-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]thiourea |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(O)c(/N=N/C(=S)NC3CCCCC3)c2c1 |
| InChI | InChI=1S/C15H17N5O3S/c21-14-13(11-8-10(20(22)23)6-7-12(11)17-14)18-19-15(24)16-9-4-2-1-3-5-9/h6-9,17,21H,1-5H2,(H,16,24)/b19-18+ |
| InChIKey | WIWDQKQKCKQMLU-VHEBQXMUSA-N |
| XLogP | 4.07 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|