C16H13N5O4S — CID 135763300
1-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3-(3-methoxyphenyl)thiourea (PubChem CID 135763300) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is 1-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135763300 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)/N=N/c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C16H13N5O4S/c1-25-11-4-2-3-9(7-11)17-16(26)20-19-14-12-8-10(21(23)24)5-6-13(12)18-15(14)22/h2-8,18,22H,1H3,(H,17,26)/b20-19+ |
| InChIKey | NWNDGKNEROPHQH-FMQUCBEESA-N |
| XLogP | 4.27 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|