C23H16Cl2N6O6 — CID 172638845
2-[4-[(3,4-dichlorophenyl)carbamoylamino]phenoxy]-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide (PubChem CID 172638845) has the molecular formula C23H16Cl2N6O6 and a molecular weight of 543.32 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)carbamoylamino]phenoxy]-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)carbamoylamino]phenoxy]-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 172638845 |
| Molecular Formula | C23H16Cl2N6O6 |
| Molecular Weight | 543.32 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)carbamoylamino]phenoxy]-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide |
| SMILES | O=C(COc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1)/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C23H16Cl2N6O6/c24-17-7-3-13(9-18(17)25)27-23(34)26-12-1-5-15(6-2-12)37-11-20(32)29-30-21-16-10-14(31(35)36)4-8-19(16)28-22(21)33/h1-10,28,33H,11H2,(H2,26,27,34)/b30-29+ |
| InChIKey | JOUPFSYLQPPKFH-QVIHXGFCSA-N |
| XLogP | 6.42 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|