C24H14N8O8 — CID 135486408
1-N,4-N-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzene-1,4-dicarboxamide (PubChem CID 135486408) has the molecular formula C24H14N8O8 and a molecular weight of 542.42 g/mol. Its IUPAC name is 1-N,4-N-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 135486408 |
| Molecular Formula | C24H14N8O8 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 1-N,4-N-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzene-1,4-dicarboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12)c1ccc(C(=O)/N=N/c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C24H14N8O8/c33-21(29-27-19-15-9-13(31(37)38)5-7-17(15)25-23(19)35)11-1-2-12(4-3-11)22(34)30-28-20-16-10-14(32(39)40)6-8-18(16)26-24(20)36/h1-10,25-26,35-36H/b29-27+,30-28+ |
| InChIKey | QPHRHQFOWMBRAL-QAVVBOBSSA-N |
| XLogP | 5.72 |
| TPSA | 241.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|