C22H13ClN6O4 — CID 172646008
2-(4-chlorophenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3H-benzimidazole-5-carboxamide (PubChem CID 172646008) has the molecular formula C22H13ClN6O4 and a molecular weight of 460.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 172646008 |
| Molecular Formula | C22H13ClN6O4 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12)c1ccc2nc(-c3ccc(Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H13ClN6O4/c23-13-4-1-11(2-5-13)20-24-17-7-3-12(9-18(17)25-20)21(30)28-27-19-15-10-14(29(32)33)6-8-16(15)26-22(19)31/h1-10,26,31H,(H,24,25)/b28-27+ |
| InChIKey | KMZCESJCNQPWCT-BYYHNAKLSA-N |
| XLogP | 5.90 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|