C22H13Cl2N5O2 — CID 172646016
N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-chlorophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 172646016) has the molecular formula C22H13Cl2N5O2 and a molecular weight of 450.29 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-chlorophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-chlorophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 172646016 |
| Molecular Formula | C22H13Cl2N5O2 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-2-(4-chlorophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(Cl)cc12)c1ccc2nc(-c3ccc(Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H13Cl2N5O2/c23-13-4-1-11(2-5-13)20-25-17-7-3-12(9-18(17)26-20)21(30)29-28-19-15-10-14(24)6-8-16(15)27-22(19)31/h1-10,27,31H,(H,25,26)/b29-28+ |
| InChIKey | PVIJRGIHTHEISW-ZQHSETAFSA-N |
| XLogP | 6.65 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|