C23H15ClN6O2 — CID 135957695
N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 135957695) has the molecular formula C23H15ClN6O2 and a molecular weight of 442.87 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135957695 |
| Molecular Formula | C23H15ClN6O2 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(Cl)cc12)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H15ClN6O2/c24-15-11-12-18-17(13-15)19(22(31)25-18)27-28-23(32)20-26-21(14-7-3-1-4-8-14)30(29-20)16-9-5-2-6-10-16/h1-13,25,31H/b28-27+ |
| InChIKey | BGBXWXUXLTWOFP-BYYHNAKLSA-N |
| XLogP | 5.70 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|