C19H15ClN6O3 — CID 155557998
N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 155557998) has the molecular formula C19H15ClN6O3 and a molecular weight of 410.82 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 155557998 |
| Molecular Formula | C19H15ClN6O3 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-1H-indol-3-yl)imino]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | COc1ccc(Cn2cc(C(=O)/N=N/c3c(O)[nH]c4ccc(Cl)cc34)nn2)cc1 |
| InChI | InChI=1S/C19H15ClN6O3/c1-29-13-5-2-11(3-6-13)9-26-10-16(22-25-26)18(27)24-23-17-14-8-12(20)4-7-15(14)21-19(17)28/h2-8,10,21,28H,9H2,1H3/b24-23+ |
| InChIKey | BJQSJAJSZMQSOR-WCWDXBQESA-N |
| XLogP | 4.10 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|