C15H12N4O3 — CID 137172272
N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]pyridine-4-carboxamide (PubChem CID 137172272) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]pyridine-4-carboxamide.
| Compound Name | N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137172272 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]pyridine-4-carboxamide |
| SMILES | COc1ccc2[nH]c(O)c(/N=N/C(=O)c3ccncc3)c2c1 |
| InChI | InChI=1S/C15H12N4O3/c1-22-10-2-3-12-11(8-10)13(15(21)17-12)18-19-14(20)9-4-6-16-7-5-9/h2-8,17,21H,1H3/b19-18+ |
| InChIKey | SAPUHOICUAYDAX-VHEBQXMUSA-N |
| XLogP | 3.20 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|