C24H17ClF3N5O4 — CID 155523855
4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]benzamide (PubChem CID 155523855) has the molecular formula C24H17ClF3N5O4 and a molecular weight of 531.88 g/mol. Its IUPAC name is 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]benzamide.
| Compound Name | 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]benzamide |
|---|---|
| PubChem CID | 155523855 |
| Molecular Formula | C24H17ClF3N5O4 |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-[(2-hydroxy-5-methoxy-1H-indol-3-yl)imino]benzamide |
| SMILES | COc1ccc2[nH]c(O)c(/N=N/C(=O)c3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)c2c1 |
| InChI | InChI=1S/C24H17ClF3N5O4/c1-37-15-7-9-19-16(11-15)20(22(35)31-19)32-33-21(34)12-2-4-13(5-3-12)29-23(36)30-14-6-8-18(25)17(10-14)24(26,27)28/h2-11,31,35H,1H3,(H2,29,30,36)/b33-32+ |
| InChIKey | MAQBNAZUQQDJJG-ULIFNZDWSA-N |
| XLogP | 7.12 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|