C24H17ClF3N3O3 — CID 46198423
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-methoxyquinolin-4-yl)oxyphenyl]urea (PubChem CID 46198423) has the molecular formula C24H17ClF3N3O3 and a molecular weight of 487.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-methoxyquinolin-4-yl)oxyphenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-methoxyquinolin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 46198423 |
| Molecular Formula | C24H17ClF3N3O3 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-methoxyquinolin-4-yl)oxyphenyl]urea |
| SMILES | COc1ccc2nccc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)c2c1 |
| InChI | InChI=1S/C24H17ClF3N3O3/c1-33-17-7-9-21-18(13-17)22(10-11-29-21)34-16-5-2-14(3-6-16)30-23(32)31-15-4-8-20(25)19(12-15)24(26,27)28/h2-13H,1H3,(H2,30,31,32) |
| InChIKey | RRYYHZHVMYMFCY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |