C26H16ClF5N2O5 — CID 175062801
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,6-difluorophenyl]-2-oxoacetamide (PubChem CID 175062801) has the molecular formula C26H16ClF5N2O5 and a molecular weight of 566.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,6-difluorophenyl]-2-oxoacetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,6-difluorophenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175062801 |
| Molecular Formula | C26H16ClF5N2O5 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,6-difluorophenyl]-2-oxoacetamide |
| SMILES | COc1cc2nccc(Oc3cc(F)c(C(=O)C(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)c(F)c3)c2cc1OC |
| InChI | InChI=1S/C26H16ClF5N2O5/c1-37-21-10-14-19(11-22(21)38-2)33-6-5-20(14)39-13-8-17(28)23(18(29)9-13)24(35)25(36)34-12-3-4-16(27)15(7-12)26(30,31)32/h3-11H,1-2H3,(H,34,36) |
| InChIKey | XWMOFXZICCHMPK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|