C15H11BrN4O2 — CID 1368694
4-amino-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]benzamide (PubChem CID 1368694) has the molecular formula C15H11BrN4O2 and a molecular weight of 359.18 g/mol. Its IUPAC name is 4-amino-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]benzamide.
| Compound Name | 4-amino-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
|---|---|
| PubChem CID | 1368694 |
| Molecular Formula | C15H11BrN4O2 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 4-amino-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]benzamide |
| SMILES | Nc1ccc(C(=O)/N=N/c2c(O)[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C15H11BrN4O2/c16-9-3-6-12-11(7-9)13(15(22)18-12)19-20-14(21)8-1-4-10(17)5-2-8/h1-7,18,22H,17H2/b20-19+ |
| InChIKey | CYOZAXNTUULXHH-FMQUCBEESA-N |
| XLogP | 4.14 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|