C15H12BrN5O2 — CID 1356481
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 1356481) has the molecular formula C15H12BrN5O2 and a molecular weight of 374.20 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1356481 |
| Molecular Formula | C15H12BrN5O2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(Br)cc12)c1n[nH]c2c1CCC2 |
| InChI | InChI=1S/C15H12BrN5O2/c16-7-4-5-10-9(6-7)13(14(22)17-10)20-21-15(23)12-8-2-1-3-11(8)18-19-12/h4-6,17,22H,1-3H2,(H,18,19)/b21-20+ |
| InChIKey | UHENVAMFPQZUDH-QZQOTICOSA-N |
| XLogP | 3.77 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|