C21H15BrN4O3 — CID 171365021
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-6-(2-hydroxyphenyl)-2-methylpyridine-3-carboxamide (PubChem CID 171365021) has the molecular formula C21H15BrN4O3 and a molecular weight of 451.28 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-6-(2-hydroxyphenyl)-2-methylpyridine-3-carboxamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-6-(2-hydroxyphenyl)-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 171365021 |
| Molecular Formula | C21H15BrN4O3 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-6-(2-hydroxyphenyl)-2-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2O)ccc1C(=O)/N=N/c1c(O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C21H15BrN4O3/c1-11-13(7-9-16(23-11)14-4-2-3-5-18(14)27)20(28)26-25-19-15-10-12(22)6-8-17(15)24-21(19)29/h2-10,24,27,29H,1H3/b26-25+ |
| InChIKey | MDJKZZFYAZBFGU-OCEACIFDSA-N |
| XLogP | 5.64 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|