C18H16BrN3O2S — CID 137077951
(2R)-2-benzylsulfanyl-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]propanamide (PubChem CID 137077951) has the molecular formula C18H16BrN3O2S and a molecular weight of 418.32 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]propanamide.
| Compound Name | (2R)-2-benzylsulfanyl-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]propanamide |
|---|---|
| PubChem CID | 137077951 |
| Molecular Formula | C18H16BrN3O2S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | (2R)-2-benzylsulfanyl-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]propanamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)/N=N/c1c(O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H16BrN3O2S/c1-11(25-10-12-5-3-2-4-6-12)17(23)22-21-16-14-9-13(19)7-8-15(14)20-18(16)24/h2-9,11,20,24H,10H2,1H3/b22-21+/t11-/m1/s1 |
| InChIKey | NFOGUXCKGUHBLD-RCJUYNGUSA-N |
| XLogP | 5.57 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|