C16H20BrN3O3 — CID 135580479
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-3-ethyl-2-hydroxyhexanamide (PubChem CID 135580479) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-3-ethyl-2-hydroxyhexanamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-3-ethyl-2-hydroxyhexanamide |
|---|---|
| PubChem CID | 135580479 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-3-ethyl-2-hydroxyhexanamide |
| SMILES | CCCC(CC)C(O)C(=O)/N=N/c1c(O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H20BrN3O3/c1-3-5-9(4-2)14(21)16(23)20-19-13-11-8-10(17)6-7-12(11)18-15(13)22/h6-9,14,18,21-22H,3-5H2,1-2H3/b20-19+ |
| InChIKey | KHUNZVQMFRGKCU-FMQUCBEESA-N |
| XLogP | 4.43 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|