C22H15BrClN3O2S — CID 137172327
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 137172327) has the molecular formula C22H15BrClN3O2S and a molecular weight of 500.81 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 137172327 |
| Molecular Formula | C22H15BrClN3O2S |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 498.98 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(Br)cc12)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H15BrClN3O2S/c23-15-5-10-19-18(11-15)20(22(29)25-19)26-27-21(28)14-3-1-13(2-4-14)12-30-17-8-6-16(24)7-9-17/h1-11,25,29H,12H2/b27-26+ |
| InChIKey | RGDPACPRRHSJHD-CYYJNZCTSA-N |
| XLogP | 7.51 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|