C29H22BrClN4O4S — CID 137107402
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 137107402) has the molecular formula C29H22BrClN4O4S and a molecular weight of 637.94 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 137107402 |
| Molecular Formula | C29H22BrClN4O4S |
| Molecular Weight | 637.94 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc2C(=O)/N=N/c2c(O)[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C29H22BrClN4O4S/c1-18-6-13-22(14-7-18)40(38,39)35(17-19-8-11-21(31)12-9-19)26-5-3-2-4-23(26)28(36)34-33-27-24-16-20(30)10-15-25(24)32-29(27)37/h2-16,32,37H,17H2,1H3/b34-33+ |
| InChIKey | PKHVQMINIKAAGV-JEIPZWNWSA-N |
| XLogP | 7.92 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.94 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|