C23H18BrClN4O5S — CID 137043579
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide (PubChem CID 137043579) has the molecular formula C23H18BrClN4O5S and a molecular weight of 577.84 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 137043579 |
| Molecular Formula | C23H18BrClN4O5S |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)/N=N/c2c(O)[nH]c3ccc(Br)cc23)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H18BrClN4O5S/c1-34-17-6-8-18(9-7-17)35(32,33)29(16-4-2-3-15(25)12-16)13-21(30)27-28-22-19-11-14(24)5-10-20(19)26-23(22)31/h2-12,26,31H,13H2,1H3/b28-27+ |
| InChIKey | HIIOMNALWMJHBJ-BYYHNAKLSA-N |
| XLogP | 5.80 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|