C24H19BrClN5O7S — CID 137059969
N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 137059969) has the molecular formula C24H19BrClN5O7S and a molecular weight of 636.87 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 137059969 |
| Molecular Formula | C24H19BrClN5O7S |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 634.99 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)/N=N/c1c(O)[nH]c2ccc(Br)cc12)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19BrClN5O7S/c1-13-3-6-16(11-19(13)31(34)35)39(36,37)30(20-10-15(26)5-8-21(20)38-2)12-22(32)28-29-23-17-9-14(25)4-7-18(17)27-24(23)33/h3-11,27,33H,12H2,1-2H3/b29-28+ |
| InChIKey | RNIWEWLNEVDVFQ-ZQHSETAFSA-N |
| XLogP | 6.02 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|