C21H23N3O5 — CID 2424477
N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide (PubChem CID 2424477) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2424477 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)/N=N/c2c(O)[nH]c3ccc(C(C)C)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5/c1-11(2)12-6-7-15-14(8-12)18(21(26)22-15)23-24-20(25)13-9-16(27-3)19(29-5)17(10-13)28-4/h6-11,22,26H,1-5H3/b24-23+ |
| InChIKey | PWOONQDFOJIGRO-WCWDXBQESA-N |
| XLogP | 4.95 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|