C20H19N3O7 — CID 135710506
N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3,4,5-trimethoxybenzamide (PubChem CID 135710506) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135710506 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)/N=N/c2c(O)[nH]c3cc4c(cc23)OCCO4)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N3O7/c1-26-15-6-10(7-16(27-2)18(15)28-3)19(24)23-22-17-11-8-13-14(30-5-4-29-13)9-12(11)21-20(17)25/h6-9,21,25H,4-5H2,1-3H3/b23-22+ |
| InChIKey | WBRCBGUAFWQWLV-GHVJWSGMSA-N |
| XLogP | 3.59 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|