C18H17N3O5S — CID 135722923
N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-2,5-dimethylbenzenesulfonamide (PubChem CID 135722923) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135722923 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)/N=N/c2c(O)[nH]c3cc4c(cc23)OCCO4)c1 |
| InChI | InChI=1S/C18H17N3O5S/c1-10-3-4-11(2)16(7-10)27(23,24)21-20-17-12-8-14-15(26-6-5-25-14)9-13(12)19-18(17)22/h3-4,7-9,19,22H,5-6H2,1-2H3/b21-20+ |
| InChIKey | YQPAVKRBKYREAG-QZQOTICOSA-N |
| XLogP | 3.73 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|