C18H16N4O4S — CID 135731272
1-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3-(2-methoxyphenyl)thiourea (PubChem CID 135731272) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135731272 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C18H16N4O4S/c1-24-13-5-3-2-4-11(13)20-18(27)22-21-16-10-8-14-15(26-7-6-25-14)9-12(10)19-17(16)23/h2-5,8-9,19,23H,6-7H2,1H3,(H,20,27)/b22-21+ |
| InChIKey | WECVGLXONKZGBQ-QURGRASLSA-N |
| XLogP | 4.13 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|