C15H15N3O6S — CID 135817876
(3S)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817876) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is (3S)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3S)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817876 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3S)-N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15N3O6S/c19-14(8-1-4-25(21,22)7-8)18-17-13-9-5-11-12(24-3-2-23-11)6-10(9)16-15(13)20/h5-6,8,16,20H,1-4,7H2/b18-17+/t8-/m1/s1 |
| InChIKey | MYEOVMPHDGKXOH-MJABNSBKSA-N |
| XLogP | 1.69 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|