C13H12BrN3O4S — CID 135817760
(3R)-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817760) has the molecular formula C13H12BrN3O4S and a molecular weight of 386.23 g/mol. Its IUPAC name is (3R)-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817760 |
| Molecular Formula | C13H12BrN3O4S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | (3R)-N-[(5-bromo-2-hydroxy-1H-indol-3-yl)imino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(Br)cc12)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H12BrN3O4S/c14-8-1-2-10-9(5-8)11(13(19)15-10)16-17-12(18)7-3-4-22(20,21)6-7/h1-2,5,7,15,19H,3-4,6H2/b17-16+/t7-/m0/s1 |
| InChIKey | PXVUXXRUVMSVGQ-MCRSIHQASA-N |
| XLogP | 2.68 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|