C14H15N3O4S — CID 135736582
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (PubChem CID 135736582) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 135736582 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H15N3O4S/c18-12(7-9-5-6-22(20,21)8-9)16-17-13-10-3-1-2-4-11(10)15-14(13)19/h1-4,9,15,19H,5-8H2/b17-16+/t9-/m0/s1 |
| InChIKey | XFQQIOFAGOAJAW-DKIZVAMUSA-N |
| XLogP | 2.31 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|