C16H13BrN4O4S — CID 135957644
2-[(4-bromophenyl)sulfonylamino]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (PubChem CID 135957644) has the molecular formula C16H13BrN4O4S and a molecular weight of 437.28 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 135957644 |
| Molecular Formula | C16H13BrN4O4S |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Br)cc1)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C16H13BrN4O4S/c17-10-5-7-11(8-6-10)26(24,25)18-9-14(22)20-21-15-12-3-1-2-4-13(12)19-16(15)23/h1-8,18-19,23H,9H2/b21-20+ |
| InChIKey | CGSASAAPPOFQMR-QZQOTICOSA-N |
| XLogP | 3.22 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|