C17H15FN4O4S — CID 4207939
2-(2-fluoro-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (PubChem CID 4207939) has the molecular formula C17H15FN4O4S and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-(2-fluoro-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 4207939 |
| Molecular Formula | C17H15FN4O4S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)/N=N/c1c(O)[nH]c2ccccc12)c1ccccc1F |
| InChI | InChI=1S/C17H15FN4O4S/c1-27(25,26)22(14-9-5-3-7-12(14)18)10-15(23)20-21-16-11-6-2-4-8-13(11)19-17(16)24/h2-9,19,24H,10H2,1H3/b21-20+ |
| InChIKey | CPRWVFICYDDRQH-QZQOTICOSA-N |
| XLogP | 3.09 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|