C19H20N4O4S — CID 137077873
2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (PubChem CID 137077873) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 137077873 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-(2,6-dimethyl-N-methylsulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| SMILES | Cc1cccc(C)c1N(CC(=O)/N=N/c1c(O)[nH]c2ccccc12)S(C)(=O)=O |
| InChI | InChI=1S/C19H20N4O4S/c1-12-7-6-8-13(2)18(12)23(28(3,26)27)11-16(24)21-22-17-14-9-4-5-10-15(14)20-19(17)25/h4-10,20,25H,11H2,1-3H3/b22-21+ |
| InChIKey | GMFPTXNLFBHIMZ-QURGRASLSA-N |
| XLogP | 3.57 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|