C18H15N5O4 — CID 135981199
N'-[(2-hydroxy-1H-indol-3-yl)imino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanediamide (PubChem CID 135981199) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is N'-[(2-hydroxy-1H-indol-3-yl)imino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanediamide.
| Compound Name | N'-[(2-hydroxy-1H-indol-3-yl)imino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 135981199 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N'-[(2-hydroxy-1H-indol-3-yl)imino]-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)N/N=C/c1ccccc1O)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15N5O4/c24-14-8-4-1-5-11(14)10-19-21-15(25)9-16(26)22-23-17-12-6-2-3-7-13(12)20-18(17)27/h1-8,10,20,24,27H,9H2,(H,21,25)/b19-10+,23-22+ |
| InChIKey | QSFPSTXDJXFKFI-PARPCHHYSA-N |
| XLogP | 2.73 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|