C17H13N3O3 — CID 135492206
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 135492206) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135492206 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H13N3O3/c21-15-8-4-1-5-11(15)10-18-20-17(23)13-9-16(22)19-14-7-3-2-6-12(13)14/h1-10,21H,(H,19,22)(H,20,23)/b18-10+ |
| InChIKey | LNPIXLAODUWSKY-VCHYOVAHSA-N |
| XLogP | 2.00 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|