C21H15N3O3 — CID 135608103
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 135608103) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135608103 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H15N3O3/c25-19-10-9-13-5-1-2-6-14(13)17(19)12-22-24-21(27)16-11-20(26)23-18-8-4-3-7-15(16)18/h1-12,25H,(H,23,26)(H,24,27)/b22-12+ |
| InChIKey | JLCXIMWPXJGAGU-WSDLNYQXSA-N |
| XLogP | 3.15 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|