C18H13N3O6 — CID 135710574
N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,3-benzodioxole-5-carboxamide (PubChem CID 135710574) has the molecular formula C18H13N3O6 and a molecular weight of 367.32 g/mol. Its IUPAC name is N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 135710574 |
| Molecular Formula | C18H13N3O6 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13N3O6/c22-17(9-1-2-12-13(5-9)27-8-26-12)21-20-16-10-6-14-15(25-4-3-24-14)7-11(10)19-18(16)23/h1-2,5-7,19,23H,3-4,8H2/b21-20+ |
| InChIKey | VILMVOPANIFWAO-QZQOTICOSA-N |
| XLogP | 3.30 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|