C16H12N4O5 — CID 135755077
8-[(2-nitrophenyl)diazenyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-7-ol (PubChem CID 135755077) has the molecular formula C16H12N4O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is 8-[(2-nitrophenyl)diazenyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-7-ol.
| Compound Name | 8-[(2-nitrophenyl)diazenyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-7-ol |
|---|---|
| PubChem CID | 135755077 |
| Molecular Formula | C16H12N4O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 8-[(2-nitrophenyl)diazenyl]-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-7-ol |
| SMILES | O=[N+]([O-])c1ccccc1/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C16H12N4O5/c21-16-15(19-18-10-3-1-2-4-12(10)20(22)23)9-7-13-14(8-11(9)17-16)25-6-5-24-13/h1-4,7-8,17,21H,5-6H2/b19-18+ |
| InChIKey | SOLUYJCDEJCGES-VHEBQXMUSA-N |
| XLogP | 3.97 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|