C22H19N5O6S — CID 135971795
2-hydroxy-N-[(4-methoxyphenyl)methyl]-3-[(2-nitrophenyl)diazenyl]-1H-indole-5-sulfonamide (PubChem CID 135971795) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-hydroxy-N-[(4-methoxyphenyl)methyl]-3-[(2-nitrophenyl)diazenyl]-1H-indole-5-sulfonamide.
| Compound Name | 2-hydroxy-N-[(4-methoxyphenyl)methyl]-3-[(2-nitrophenyl)diazenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 135971795 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-hydroxy-N-[(4-methoxyphenyl)methyl]-3-[(2-nitrophenyl)diazenyl]-1H-indole-5-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc3[nH]c(O)c(/N=N/c4ccccc4[N+](=O)[O-])c3c2)cc1 |
| InChI | InChI=1S/C22H19N5O6S/c1-33-15-8-6-14(7-9-15)13-23-34(31,32)16-10-11-18-17(12-16)21(22(28)24-18)26-25-19-4-2-3-5-20(19)27(29)30/h2-12,23-24,28H,13H2,1H3/b26-25+ |
| InChIKey | QZNRBGYMNJCLKC-OCEACIFDSA-N |
| XLogP | 4.68 |
| TPSA | 159.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|