C16H19N3O8S2 — CID 175434182
[4-[(4-methoxyphenyl)methylsulfamoyl]-N-methyl-2-nitroanilino] methanesulfonate (PubChem CID 175434182) has the molecular formula C16H19N3O8S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)methylsulfamoyl]-N-methyl-2-nitroanilino] methanesulfonate.
| Compound Name | [4-[(4-methoxyphenyl)methylsulfamoyl]-N-methyl-2-nitroanilino] methanesulfonate |
|---|---|
| PubChem CID | 175434182 |
| Molecular Formula | C16H19N3O8S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | [4-[(4-methoxyphenyl)methylsulfamoyl]-N-methyl-2-nitroanilino] methanesulfonate |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc(N(C)OS(C)(=O)=O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H19N3O8S2/c1-18(27-28(3,22)23)15-9-8-14(10-16(15)19(20)21)29(24,25)17-11-12-4-6-13(26-2)7-5-12/h4-10,17H,11H2,1-3H3 |
| InChIKey | DQASBLQPNSCXLP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|