C19H18N4O3S — CID 135730840
1-(2,4-dimethylphenyl)-3-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]thiourea (PubChem CID 135730840) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]thiourea |
|---|---|
| PubChem CID | 135730840 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]thiourea |
| SMILES | Cc1ccc(NC(=S)/N=N/c2c(O)[nH]c3cc4c(cc23)OCCO4)c(C)c1 |
| InChI | InChI=1S/C19H18N4O3S/c1-10-3-4-13(11(2)7-10)21-19(27)23-22-17-12-8-15-16(26-6-5-25-15)9-14(12)20-18(17)24/h3-4,7-9,20,24H,5-6H2,1-2H3,(H,21,27)/b23-22+ |
| InChIKey | WQFWFPDMGJUHKM-GHVJWSGMSA-N |
| XLogP | 4.74 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|