C31H35FN5OS+ — CID 3591015
cyclohexyl-[[3-[(2,4-dimethylphenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]methyl]-[(4-fluorophenyl)methyl]azanium (PubChem CID 3591015) has the molecular formula C31H35FN5OS+ and a molecular weight of 544.72 g/mol. Its IUPAC name is cyclohexyl-[[3-[(2,4-dimethylphenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]methyl]-[(4-fluorophenyl)methyl]azanium.
| Compound Name | cyclohexyl-[[3-[(2,4-dimethylphenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]methyl]-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 3591015 |
| Molecular Formula | C31H35FN5OS+ |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | cyclohexyl-[[3-[(2,4-dimethylphenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]methyl]-[(4-fluorophenyl)methyl]azanium |
| SMILES | Cc1ccc(NC(=S)/N=N/c2c(O)n(C[NH+](Cc3ccc(F)cc3)C3CCCCC3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C31H34FN5OS/c1-21-12-17-27(22(2)18-21)33-31(39)35-34-29-26-10-6-7-11-28(26)37(30(29)38)20-36(25-8-4-3-5-9-25)19-23-13-15-24(32)16-14-23/h6-7,10-18,25,38H,3-5,8-9,19-20H2,1-2H3,(H,33,39)/p+1/b35-34+ |
| InChIKey | PPCVNVAFDKWTAZ-XAHDOWKMSA-O |
| XLogP | 6.96 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|