C31H34ClN5OS — CID 4048745
1-(3-chloro-2-methylphenyl)-3-[1-[[cyclohexyl-[(4-methylphenyl)methyl]amino]methyl]-2-hydroxyindol-3-yl]iminothiourea (PubChem CID 4048745) has the molecular formula C31H34ClN5OS and a molecular weight of 560.17 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[1-[[cyclohexyl-[(4-methylphenyl)methyl]amino]methyl]-2-hydroxyindol-3-yl]iminothiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[1-[[cyclohexyl-[(4-methylphenyl)methyl]amino]methyl]-2-hydroxyindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 4048745 |
| Molecular Formula | C31H34ClN5OS |
| Molecular Weight | 560.17 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[1-[[cyclohexyl-[(4-methylphenyl)methyl]amino]methyl]-2-hydroxyindol-3-yl]iminothiourea |
| SMILES | Cc1ccc(CN(Cn2c(O)c(/N=N/C(=S)Nc3cccc(Cl)c3C)c3ccccc32)C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H34ClN5OS/c1-21-15-17-23(18-16-21)19-36(24-9-4-3-5-10-24)20-37-28-14-7-6-11-25(28)29(30(37)38)34-35-31(39)33-27-13-8-12-26(32)22(27)2/h6-8,11-18,24,38H,3-5,9-10,19-20H2,1-2H3,(H,33,39)/b35-34+ |
| InChIKey | XMFCITGQOIVIDH-XAHDOWKMSA-N |
| XLogP | 8.89 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.17 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|